Products 1261169-72-5
CAS 1261169-72-5 appears in our catalog under these names: 2,3–Difluoro–4–hydroxyphenylboronic acid (contains varying amounts of Anhydride), (2,3-Difluoro-4-Hydroxyphenyl)Boronic Acid, 97%, 97%, (2,3-Difluoro-4-hydroxyphenyl)boronic acid, 98%, (2,3-Difluoro-4-hydroxyphenyl)boronic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g.
(2,3-difluoro-4-hydroxyphenyl)boronic acid (CAS 1261169-72-5) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (2,3-difluoro-4-hydroxyphenyl)boronic acid. InChIKey: GKKFIHYGEYECQH-UHFFFAOYSA-N.
| Molecular formula | C6H5BF2O3 |
|---|---|
| Molecular weight | 173.91 g/mol |
| IUPAC name | (2,3-difluoro-4-hydroxyphenyl)boronic acid |
| InChIKey | GKKFIHYGEYECQH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)O)F)F)(O)O |
Computed by PubChem (NCBI)