CAS 1973391-08-0 is the registry number for (2,4-Difluoro-6-hydroxyphenyl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,4-difluoro-6-hydroxyphenyl)boronic acid (CAS 1973391-08-0) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (2,4-difluoro-6-hydroxyphenyl)boronic acid. InChIKey: ARSCWDXRBXUEEG-UHFFFAOYSA-N.
| Molecular formula | C6H5BF2O3 |
|---|---|
| Molecular weight | 173.91 g/mol |
| IUPAC name | (2,4-difluoro-6-hydroxyphenyl)boronic acid |
| InChIKey | ARSCWDXRBXUEEG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)F)O)(O)O |
Computed by PubChem (NCBI)