Products 1238196-62-7
CAS 1238196-62-7 appears in our catalog under these names: (2,3-Difluoro-6-hydroxyphenyl)boronic acid 97%, B-(2,3-Difluoro-6-hydroxyphenyl)boronic acid, 97%, 97%, (2,3-Difluoro-6-hydroxyphenyl)boronic acid, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
(2,3-difluoro-6-hydroxyphenyl)boronic acid (CAS 1238196-62-7) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (2,3-difluoro-6-hydroxyphenyl)boronic acid. InChIKey: KOWZIVQZEGPNSW-UHFFFAOYSA-N.
| Molecular formula | C6H5BF2O3 |
|---|---|
| Molecular weight | 173.91 g/mol |
| IUPAC name | (2,3-difluoro-6-hydroxyphenyl)boronic acid |
| InChIKey | KOWZIVQZEGPNSW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)F)O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2,3-difluoro-6-hydroxyphenyl)boronic acid, B-(2,3-Difluoro-6-hydroxyphenyl)boronic acid, Boronic acid, B-(2,3-difluoro-6-hydroxyphenyl)-, 2,3-Difluoro-6-hydroxyphenylboronic acid, (2,3-difluoro-6-hydroxy-phenyl)boronic Acid, 2-Hydroxy-5,6-difluorophenylboronic acid, (2,3-difluoro-6-hydroxyphenyl)boronicacid