CAS 1379466-84-8 appears in our catalog under these names: 3,4-Difluoro-5-hydroxyphenylboronic acid, 98%, 98%, 3,4-Difluoro-5-hydroxyphenylboronic acid, 98%, (3,4-Difluoro-5-hydroxyphenyl)boronic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 25g, 5g.
(3,4-difluoro-5-hydroxyphenyl)boronic acid (CAS 1379466-84-8) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (3,4-difluoro-5-hydroxyphenyl)boronic acid. InChIKey: MSOVFNUAYVHDBC-UHFFFAOYSA-N.
| Molecular formula | C6H5BF2O3 |
|---|---|
| Molecular weight | 173.91 g/mol |
| IUPAC name | (3,4-difluoro-5-hydroxyphenyl)boronic acid |
| InChIKey | MSOVFNUAYVHDBC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)F)O)(O)O |
Computed by PubChem (NCBI)