CAS 1432610-22-4 appears in our catalog under these names: B-(4,5-Difluoro-2-hydroxyphenyl)boronic acid, 96%, 96%, 4,5-Difluoro-2-hydroxyphenylboronic acid, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(4,5-difluoro-2-hydroxyphenyl)boronic acid (CAS 1432610-22-4) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (4,5-difluoro-2-hydroxyphenyl)boronic acid. InChIKey: YIKIRVLQGNKPFB-UHFFFAOYSA-N.
| Molecular formula | C6H5BF2O3 |
|---|---|
| Molecular weight | 173.91 g/mol |
| IUPAC name | (4,5-difluoro-2-hydroxyphenyl)boronic acid |
| InChIKey | YIKIRVLQGNKPFB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1O)F)F)(O)O |
Computed by PubChem (NCBI)