Products 2894848-23-6
CAS 2894848-23-6 appears in our catalog under these names: (2,4-Difluoro-3-hydroxyphenyl)boronic acid, 98%, (2,4-Difluoro-3-hydroxyphenyl)boronic acid, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2,4-difluoro-3-hydroxyphenyl)boronic acid (CAS 2894848-23-6) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (2,4-difluoro-3-hydroxyphenyl)boronic acid. InChIKey: ACRUJBWBRKOAPR-UHFFFAOYSA-N.
| Molecular formula | C6H5BF2O3 |
|---|---|
| Molecular weight | 173.91 g/mol |
| IUPAC name | (2,4-difluoro-3-hydroxyphenyl)boronic acid |
| InChIKey | ACRUJBWBRKOAPR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)O)F)(O)O |
Computed by PubChem (NCBI)