(2,6-Difluoro-3-formylphenyl)boronic acid, 97%
cas: 849062-09-5 — see every product listed under this CAS number, including other names
(2,6-Difluoro-3-formylphenyl)boronic acid, 97% (CAS 849062-09-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222444-1G |
| cas | 849062-09-5 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 1070.47 Pln | |
| Fluorochem | 10g | 2080.54 Pln | |
| Fluorochem | 25g | 4402.63 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2,6-difluoro-3-formylphenyl)boronic acid (CAS 849062-09-5) is a chemical compound with the molecular formula C7H5BF2O3 and a molecular weight of 185.92 g/mol. IUPAC name: (2,6-difluoro-3-formylphenyl)boronic acid. InChIKey: GLQAPMRINNTHGJ-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O3 |
|---|---|
| Molecular weight | 185.92 g/mol |
| IUPAC name | (2,6-difluoro-3-formylphenyl)boronic acid |
| InChIKey | GLQAPMRINNTHGJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)C=O)F)(O)O |
Computed by PubChem (NCBI)