CAS 957065-87-1 appears in our catalog under these names: 2,6–Difluoro–4–hydroxyphenylboronic acid, (2,6-Difluoro-4-Hydroxyphenyl)Boronic Acid, 96%, 96%, (2,6-Difluoro-4-hydroxyphenyl)boronic acid, 96%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg, 25g.
(2,6-difluoro-4-hydroxyphenyl)boronic acid (CAS 957065-87-1) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (2,6-difluoro-4-hydroxyphenyl)boronic acid. InChIKey: JPAMLWIQHDPWGK-UHFFFAOYSA-N.
| Molecular formula | C6H5BF2O3 |
|---|---|
| Molecular weight | 173.91 g/mol |
| IUPAC name | (2,6-difluoro-4-hydroxyphenyl)boronic acid |
| InChIKey | JPAMLWIQHDPWGK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)O)F)(O)O |
Computed by PubChem (NCBI)