cas: 1135992-31-2 — see every product listed under this CAS number, including other names
(2-Chloro-4-(methoxymethoxy)phenyl)boronic acid, 98+% (CAS 1135992-31-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A542288-25g |
| cas | 1135992-31-2 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 65235.10 Pln | |
| AmBeed | 10g | 33244.96 Pln | |
| AmBeed | 5g | 19534.90 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
[2-chloro-4-(methoxymethoxy)phenyl]boronic acid (CAS 1135992-31-2) is a chemical compound with the molecular formula C8H10BClO4 and a molecular weight of 216.43 g/mol. IUPAC name: [2-chloro-4-(methoxymethoxy)phenyl]boronic acid. InChIKey: PEGAMAHZAZSGFS-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO4 |
|---|---|
| Molecular weight | 216.43 g/mol |
| IUPAC name | [2-chloro-4-(methoxymethoxy)phenyl]boronic acid |
| InChIKey | PEGAMAHZAZSGFS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OCOC)Cl)(O)O |
Computed by PubChem (NCBI)