CAS 750585-61-6 is the registry number for (3-Chloro-2,4-dimethoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3-chloro-2,4-dimethoxyphenyl)boronic acid (CAS 750585-61-6) is a chemical compound with the molecular formula C8H10BClO4 and a molecular weight of 216.43 g/mol. IUPAC name: (3-chloro-2,4-dimethoxyphenyl)boronic acid. InChIKey: ANGLQGBCFZWGHY-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO4 |
|---|---|
| Molecular weight | 216.43 g/mol |
| IUPAC name | (3-chloro-2,4-dimethoxyphenyl)boronic acid |
| InChIKey | ANGLQGBCFZWGHY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OC)Cl)OC)(O)O |
Computed by PubChem (NCBI)