Products 427886-21-3
CAS 427886-21-3 appears in our catalog under these names: B-(4-Chloro-3,5-dimethoxyphenyl)boronic acid, 98%, 98%, (4-Chloro-3,5-dimethoxyphenyl)boronic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4-chloro-3,5-dimethoxyphenyl)boronic acid (CAS 427886-21-3) is a chemical compound with the molecular formula C8H10BClO4 and a molecular weight of 216.43 g/mol. IUPAC name: (4-chloro-3,5-dimethoxyphenyl)boronic acid. InChIKey: YAWMKFIUWSYMGN-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO4 |
|---|---|
| Molecular weight | 216.43 g/mol |
| IUPAC name | (4-chloro-3,5-dimethoxyphenyl)boronic acid |
| InChIKey | YAWMKFIUWSYMGN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)OC)Cl)OC)(O)O |
Computed by PubChem (NCBI)