CAS 2641796-13-4 appears in our catalog under these names: (6-Chloro-2,3-dimethoxyphenyl)boronic acid, 98%, (6-Chloro-2,3-dimethoxyphenyl)boronic acid, 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
(6-chloro-2,3-dimethoxyphenyl)boronic acid (CAS 2641796-13-4) is a chemical compound with the molecular formula C8H10BClO4 and a molecular weight of 216.43 g/mol. IUPAC name: (6-chloro-2,3-dimethoxyphenyl)boronic acid. InChIKey: LEHQCTAAMMSYCL-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO4 |
|---|---|
| Molecular weight | 216.43 g/mol |
| IUPAC name | (6-chloro-2,3-dimethoxyphenyl)boronic acid |
| InChIKey | LEHQCTAAMMSYCL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1OC)OC)Cl)(O)O |
Computed by PubChem (NCBI)