Products 2275572-12-6
CAS 2275572-12-6 is the registry number for (4-chloro-2-(methoxymethoxy)phenyl)boronic acid, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
[4-chloro-2-(methoxymethoxy)phenyl]boronic acid (CAS 2275572-12-6) is a chemical compound with the molecular formula C8H10BClO4 and a molecular weight of 216.43 g/mol. IUPAC name: [4-chloro-2-(methoxymethoxy)phenyl]boronic acid. InChIKey: ZNOWREWTFBTJOP-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO4 |
|---|---|
| Molecular weight | 216.43 g/mol |
| IUPAC name | [4-chloro-2-(methoxymethoxy)phenyl]boronic acid |
| InChIKey | ZNOWREWTFBTJOP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Cl)OCOC)(O)O |
Computed by PubChem (NCBI)