cas: 870778-87-3 — see every product listed under this CAS number, including other names
(2-Ethoxy-4,5-difluorophenyl)boronic acid, 98%, 98% (CAS 870778-87-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KHS-100mg |
| cas | 870778-87-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 1322.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2-ethoxy-4,5-difluorophenyl)boronic acid (CAS 870778-87-3) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (2-ethoxy-4,5-difluorophenyl)boronic acid. InChIKey: DIDGIGNOIJJEGJ-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (2-ethoxy-4,5-difluorophenyl)boronic acid |
| InChIKey | DIDGIGNOIJJEGJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OCC)F)F)(O)O |
Computed by PubChem (NCBI)