(2-Ethoxy-4,5-difluorophenyl)boronic acid, 98%
cas: 870778-87-3 — see every product listed under this CAS number, including other names
(2-Ethoxy-4,5-difluorophenyl)boronic acid, 98% (CAS 870778-87-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg, 100mg. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F338095-1G |
| cas | 870778-87-3 |
| size | 1g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 1080.89 Pln | |
| Fluorochem | 10g | 1965.99 Pln | |
| Fluorochem | 25g | 3236.38 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 1087.94 Pln | |
| Ambeed | 10g | 1961.25 Pln | |
| Ambeed | 25g | 3212.81 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 1322.00 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(2-ethoxy-4,5-difluorophenyl)boronic acid (CAS 870778-87-3) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (2-ethoxy-4,5-difluorophenyl)boronic acid. InChIKey: DIDGIGNOIJJEGJ-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (2-ethoxy-4,5-difluorophenyl)boronic acid |
| InChIKey | DIDGIGNOIJJEGJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OCC)F)F)(O)O |
Computed by PubChem (NCBI)