cas: 870778-87-3 — see every product listed under this CAS number, including other names
(2-Ethoxy-4,5-difluorophenyl)boronic acid, 98% (CAS 870778-87-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F338095-1G |
| cas | 870778-87-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 284.29 Pln | |
| Fluorochem | 5g | 1028.82 Pln | |
| Fluorochem | 10g | 1887.89 Pln | |
| Fluorochem | 25g | 3111.42 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2-ethoxy-4,5-difluorophenyl)boronic acid (CAS 870778-87-3) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (2-ethoxy-4,5-difluorophenyl)boronic acid. InChIKey: DIDGIGNOIJJEGJ-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (2-ethoxy-4,5-difluorophenyl)boronic acid |
| InChIKey | DIDGIGNOIJJEGJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OCC)F)F)(O)O |
Computed by PubChem (NCBI)