(3,5-Dichloro-2-methoxyphenyl)boronic acid, 98%
cas: 2573074-25-4 — see every product listed under this CAS number, including other names
(3,5-Dichloro-2-methoxyphenyl)boronic acid, 98% (CAS 2573074-25-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1538892-5g |
| cas | 2573074-25-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 48816.88 Pln | |
| AmBeed | 10g | 82922.77 Pln | |
| AmBeed | 1g | 13695.43 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3,5-dichloro-2-methoxyphenyl)boronic acid (CAS 2573074-25-4) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: (3,5-dichloro-2-methoxyphenyl)boronic acid. InChIKey: MJRIIYDEDWEQSN-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O3 |
|---|---|
| Molecular weight | 220.84 g/mol |
| IUPAC name | (3,5-dichloro-2-methoxyphenyl)boronic acid |
| InChIKey | MJRIIYDEDWEQSN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OC)Cl)Cl)(O)O |
Computed by PubChem (NCBI)