CAS 1221263-05-3 is the registry number for (2,4-Dichloro-6-methoxyphenyl)boronic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
(2,4-dichloro-6-methoxyphenyl)boronic acid (CAS 1221263-05-3) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: (2,4-dichloro-6-methoxyphenyl)boronic acid. InChIKey: JCUAJNNGSNVWQJ-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O3 |
|---|---|
| Molecular weight | 220.84 g/mol |
| IUPAC name | (2,4-dichloro-6-methoxyphenyl)boronic acid |
| InChIKey | JCUAJNNGSNVWQJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1Cl)Cl)OC)(O)O |
Computed by PubChem (NCBI)