Products 851756-57-5
CAS 851756-57-5 appears in our catalog under these names: (2,6-dichloro-3-methoxyphenyl)boronic acid, 95%, 95%, (2,6-Dichloro-3-methoxyphenyl)boronic acid, 98%, (2,6-Dichloro-3-methoxyphenyl)boronic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2,6-dichloro-3-methoxyphenyl)boronic acid (CAS 851756-57-5) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: (2,6-dichloro-3-methoxyphenyl)boronic acid. InChIKey: YSIVMUOSCRYSHE-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O3 |
|---|---|
| Molecular weight | 220.84 g/mol |
| IUPAC name | (2,6-dichloro-3-methoxyphenyl)boronic acid |
| InChIKey | YSIVMUOSCRYSHE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Cl)OC)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2,6-Dichloro-3-methoxyphenyl)boronic acid, 2,6-Dichloro-3-methoxyphenylboronic acid, C7H7BCl2O3, (2,6-Dichloro-3-methoxy-phenyl)boronic acid, (2,6-Dichloro-3-methoxyphenyl)boronicacid, (2,6-Dichloro-3-methoxyphenyl), Boronic acid, B-(2,6-dichloro-3-Methoxyphenyl)-, (2,6-dichloro-3-methoxyphenyl)boronic acid - [D70160]