cas: 1150114-51-4 — see every product listed under this CAS number, including other names
(3,5-Difluoro-2-hydroxyphenyl)boronic acid, 97% (CAS 1150114-51-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209629-100MG |
| cas | 1150114-51-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 185.37 Pln | |
| Fluorochem | 250mg | 263.47 Pln | |
| Fluorochem | 1g | 758.08 Pln | |
| Fluorochem | 5g | 2455.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3,5-difluoro-2-hydroxyphenyl)boronic acid (CAS 1150114-51-4) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (3,5-difluoro-2-hydroxyphenyl)boronic acid. InChIKey: DMZXNOGEVAESIC-UHFFFAOYSA-N.
| Molecular formula | C6H5BF2O3 |
|---|---|
| Molecular weight | 173.91 g/mol |
| IUPAC name | (3,5-difluoro-2-hydroxyphenyl)boronic acid |
| InChIKey | DMZXNOGEVAESIC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1O)F)F)(O)O |
Computed by PubChem (NCBI)