(3,5-Difluoro-4-formylphenyl)boronic acid, 95%
cas: 870718-11-9 — see every product listed under this CAS number, including other names
(3,5-Difluoro-4-formylphenyl)boronic acid, 95% (CAS 870718-11-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F323810-250MG |
| cas | 870718-11-9 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 310.33 Pln | |
| Fluorochem | 10g | 549.82 Pln | |
| Fluorochem | 25g | 1185.02 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 309.19 Pln | |
| Ambeed | 10g | 542.81 Pln | |
| Ambeed | 25g | 1149.12 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 325.47 Pln | |
| BLDpharm | 10g | 575.38 Pln | |
| BLDpharm | 25g | 1241.81 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(3,5-difluoro-4-formylphenyl)boronic acid (CAS 870718-11-9) is a chemical compound with the molecular formula C7H5BF2O3 and a molecular weight of 185.92 g/mol. IUPAC name: (3,5-difluoro-4-formylphenyl)boronic acid. InChIKey: XWZOKATWICIEMU-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O3 |
|---|---|
| Molecular weight | 185.92 g/mol |
| IUPAC name | (3,5-difluoro-4-formylphenyl)boronic acid |
| InChIKey | XWZOKATWICIEMU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)C=O)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3,5-Difluoro-4-formylphenylboronic acid, (3,5-Difluoro-4-formylphenyl)boronic acid, (3,5-Difluoro-4-formylphenyl)boronicacid, XWZOKATWICIEMU-UHFFFAOYSA-N, (3,5-difluoro-4-formyl-phenyl)boronic acid, 3,5-Difluoro-4-formylphenylboronic acid, >=95%, 3,5-Difluoro-4-formylphenylboronic acid(contains varying amounts of Anhydride)