cas: 208641-98-9 — see every product listed under this CAS number, including other names
(3,5-Difluoro-4-methoxyphenyl)boronic acid 97% (CAS 208641-98-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A131177-250mg |
| cas | 208641-98-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 25g | 1171.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A131177 |
(3,5-difluoro-4-methoxyphenyl)boronic acid (CAS 208641-98-9) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (3,5-difluoro-4-methoxyphenyl)boronic acid. InChIKey: JJRIEFCRGWHLES-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (3,5-difluoro-4-methoxyphenyl)boronic acid |
| InChIKey | JJRIEFCRGWHLES-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)OC)F)(O)O |
Computed by PubChem (NCBI)