(3-(2-Methoxy-2-oxoethoxy)phenyl)boronic acid, 95%
cas: 1256355-55-1 — see every product listed under this CAS number, including other names
(3-(2-Methoxy-2-oxoethoxy)phenyl)boronic acid, 95% (CAS 1256355-55-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A545050-100mg |
| cas | 1256355-55-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 298.06 Pln | |
| Ambeed | 1g | 654.06 Pln | |
| Ambeed | 5g | 1888.94 Pln | |
| Ambeed | 25g | 5554.62 Pln | |
| BLDpharm | 100mg | 231.05 Pln | |
| BLDpharm | 250mg | 314.36 Pln | |
| BLDpharm | 1g | 697.56 Pln | |
| BLDpharm | 5g | 2030.42 Pln | |
| BLDpharm | 25g | 5984.58 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
[3-(2-methoxy-2-oxoethoxy)phenyl]boronic acid (CAS 1256355-55-1) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: [3-(2-methoxy-2-oxoethoxy)phenyl]boronic acid. InChIKey: VSRAAFKSKNZJMC-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | [3-(2-methoxy-2-oxoethoxy)phenyl]boronic acid |
| InChIKey | VSRAAFKSKNZJMC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCC(=O)OC)(O)O |
Computed by PubChem (NCBI)