Products 1256355-55-1
CAS 1256355-55-1 appears in our catalog under these names: (3-(2-Methoxy-2-oxoethoxy)phenyl)boronic acid, 98%, (3-(2-Methoxy-2-oxoethoxy)phenyl)boronic acid, 95%, 3-(2-Methoxy-2-oxoethoxy)phenylboronic acid, 97%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
[3-(2-methoxy-2-oxoethoxy)phenyl]boronic acid (CAS 1256355-55-1) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: [3-(2-methoxy-2-oxoethoxy)phenyl]boronic acid. InChIKey: VSRAAFKSKNZJMC-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | [3-(2-methoxy-2-oxoethoxy)phenyl]boronic acid |
| InChIKey | VSRAAFKSKNZJMC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCC(=O)OC)(O)O |
Computed by PubChem (NCBI)