cas: 58236-74-1 — see every product listed under this CAS number, including other names
(3-Bromophenyl)methanesulfonyl chloride 97% (CAS 58236-74-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A437120-250mg |
| cas | 58236-74-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 420.44 Pln | |
| Ambeed | 5g | 1154.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A437120 |
(3-bromophenyl)methanesulfonyl chloride (CAS 58236-74-1) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: (3-bromophenyl)methanesulfonyl chloride. InChIKey: VCGKEAIINMDLMC-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | (3-bromophenyl)methanesulfonyl chloride |
| InChIKey | VCGKEAIINMDLMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)