CAS 141113-98-6 appears in our catalog under these names: 2-Bromo-5-methylbenzenesulfonyl chloride, 98%, 2-Bromo-5-methylbenzene-1-sulfonyl chloride, 95%, 2-Bromo-5-methylbenzene-1-sulfonyl chloride, 98%, 2-Bromo-5-methylbenzenesulfonyl chloride. Offered by: Fluorochem, Combi-blocks, AmBeed, Biosynth. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g.
2-bromo-5-methylbenzenesulfonyl chloride (CAS 141113-98-6) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: 2-bromo-5-methylbenzenesulfonyl chloride. InChIKey: ZFCDMNSVQJUZTG-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | 2-bromo-5-methylbenzenesulfonyl chloride |
| InChIKey | ZFCDMNSVQJUZTG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)