CAS 918350-18-2 is the registry number for 2-Bromo-1-chloro-4-methanesulfonylbenzene, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
2-bromo-1-chloro-4-methylsulfonylbenzene (CAS 918350-18-2) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: 2-bromo-1-chloro-4-methylsulfonylbenzene. InChIKey: YBOJFMIMXWZZNC-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | 2-bromo-1-chloro-4-methylsulfonylbenzene |
| InChIKey | YBOJFMIMXWZZNC-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)Cl)Br |
Computed by PubChem (NCBI)