Products 1261566-57-7
CAS 1261566-57-7 appears in our catalog under these names: 2-Bromo-3-methylbenzene-1-sulfonyl chloride, 95%, 2-Bromo-3-methylbenzenesulfonyl chloride, 98%, 2-Bromo-3-methylbenzenesulfonylchloride, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-bromo-3-methylbenzenesulfonyl chloride (CAS 1261566-57-7) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: 2-bromo-3-methylbenzenesulfonyl chloride. InChIKey: PIFIURZNLONQND-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | 2-bromo-3-methylbenzenesulfonyl chloride |
| InChIKey | PIFIURZNLONQND-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)