CAS 58236-74-1 appears in our catalog under these names: 3-Bromobenzylsulfonyl chloride, 97%, (3-Bromophenyl)methanesulfonyl chloride, 97%, 3-Bromobenzylsulfonyl chloride, 97% , (3-Bromophenyl)methanesulfonyl chloride 97%. Offered by: Combi-blocks, AmBeed, Thermo Scientific, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 250mg.
(3-bromophenyl)methanesulfonyl chloride (CAS 58236-74-1) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: (3-bromophenyl)methanesulfonyl chloride. InChIKey: VCGKEAIINMDLMC-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | (3-bromophenyl)methanesulfonyl chloride |
| InChIKey | VCGKEAIINMDLMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)