Products 72256-93-0

CAS 72256-93-0 appears in our catalog under these names: 4-Bromo-3-methylbenzenesulfonyl chloride, 98%, 4-Bromo-3-methylbenzene-1-sulfonyl chloride 98%, 4-Bromo-3-methylbenzenesulfonyl chloride. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g.

Structural formula: {0} (CAS {1})

4-bromo-3-methylbenzenesulfonyl chloride (CAS 72256-93-0) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: 4-bromo-3-methylbenzenesulfonyl chloride. InChIKey: JRNDXUKMWFVEIC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6BrClO2S
Molecular weight269.54 g/mol
IUPAC name4-bromo-3-methylbenzenesulfonyl chloride
InChIKeyJRNDXUKMWFVEIC-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)S(=O)(=O)Cl)Br

Computed by PubChem (NCBI)