Products 886501-61-7
CAS 886501-61-7 appears in our catalog under these names: 3-Bromo-2-methylbenzene-1-sulfonyl chloride, 95%, 3-Bromo-2-methylbenzene-1-sulfonyl chloride 97%, 3-Bromo-2-methyl-benzenesulfonyl chloride. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
3-bromo-2-methylbenzenesulfonyl chloride (CAS 886501-61-7) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: 3-bromo-2-methylbenzenesulfonyl chloride. InChIKey: LJQINJOCKBNGAJ-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | 3-bromo-2-methylbenzenesulfonyl chloride |
| InChIKey | LJQINJOCKBNGAJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)