CAS 66176-39-4 appears in our catalog under these names: 4–(Bromomethyl)benzenesulfonyl Chloride, 4-Bromomethylbenzenesulfonyl chloride, 95%, 4-(BROMOMETHYL)BENZENESULFONYL CHLORID&, 4-(Bromomethyl)benzenesulfonyl chloride, 98%, 4-(Bromomethyl)benzenesulfonyl chloride, 95% . Offered by: GLPBio, Thermo Scientific (Acros), Sigma-Aldrich, Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 100g, 25g, 5g, 1g, 500g, 10g.
4-(bromomethyl)benzenesulfonyl chloride (CAS 66176-39-4) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: 4-(bromomethyl)benzenesulfonyl chloride. InChIKey: QXTQWYZHHMQSQH-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | 4-(bromomethyl)benzenesulfonyl chloride |
| InChIKey | QXTQWYZHHMQSQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CBr)S(=O)(=O)Cl |
Computed by PubChem (NCBI)