CAS 1782806-79-4 is the registry number for 2-Bromo-4-chloro-1-methanesulfonylbenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
2-bromo-4-chloro-1-methylsulfonylbenzene (CAS 1782806-79-4) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: 2-bromo-4-chloro-1-methylsulfonylbenzene. InChIKey: JCYOJFRWMQIAMU-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | 2-bromo-4-chloro-1-methylsulfonylbenzene |
| InChIKey | JCYOJFRWMQIAMU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C=C1)Cl)Br |
Computed by PubChem (NCBI)