Products 1029145-99-0
CAS 1029145-99-0 appears in our catalog under these names: 3-Bromo-4-methylbenzenesulfonyl chloride, 97%, 3-Bromo-4-methylbenzene-1-sulfonyl chloride, 98%, 3-Bromo-4-methylbenzenesulfonyl chloride, 3-Bromo-4-methyl-benzenesulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 250mg.
3-bromo-4-methylbenzenesulfonyl chloride (CAS 1029145-99-0) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: 3-bromo-4-methylbenzenesulfonyl chloride. InChIKey: WAABTFILMSXGKZ-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | 3-bromo-4-methylbenzenesulfonyl chloride |
| InChIKey | WAABTFILMSXGKZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)