CAS 89794-06-9 appears in our catalog under these names: 2-Bromo-4-methylbenzenesulfonyl chloride, 95%, 2-Bromo-4-methylbenzene-1-sulfonyl chloride, 95+%, 2-Bromo-4-methylbenzenesulfonyl chloride, >95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
2-bromo-4-methylbenzenesulfonyl chloride (CAS 89794-06-9) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: 2-bromo-4-methylbenzenesulfonyl chloride. InChIKey: NQXSKUPCOJGZQA-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | 2-bromo-4-methylbenzenesulfonyl chloride |
| InChIKey | NQXSKUPCOJGZQA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)