cas: 1067228-90-3 — see every product listed under this CAS number, including other names
(4-Chloro-2,6-dimethoxyphenyl)boronic acid, 97% (CAS 1067228-90-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F230056-100MG |
| cas | 1067228-90-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 440.49 Pln | |
| Fluorochem | 250mg | 450.90 Pln | |
| Fluorochem | 1g | 940.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(4-chloro-2,6-dimethoxyphenyl)boronic acid (CAS 1067228-90-3) is a chemical compound with the molecular formula C8H10BClO4 and a molecular weight of 216.43 g/mol. IUPAC name: (4-chloro-2,6-dimethoxyphenyl)boronic acid. InChIKey: VNYKXENLVGSAOC-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO4 |
|---|---|
| Molecular weight | 216.43 g/mol |
| IUPAC name | (4-chloro-2,6-dimethoxyphenyl)boronic acid |
| InChIKey | VNYKXENLVGSAOC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1OC)Cl)OC)(O)O |
Computed by PubChem (NCBI)