(4-Chloro-3,5-difluorophenyl)boronic acid, 95%
cas: 864759-63-7 — see every product listed under this CAS number, including other names
(4-Chloro-3,5-difluorophenyl)boronic acid, 95% (CAS 864759-63-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F210179-100MG |
| cas | 864759-63-7 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 768.50 Pln | |
| Fluorochem | 10g | 1466.17 Pln | |
| Fluorochem | 25g | 2705.32 Pln | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 776.44 Pln | |
| Ambeed | 25g | 2689.94 Pln | |
| BLDpharm | 250mg | 203.29 Pln | |
| BLDpharm | 1g | 292.14 Pln | |
| BLDpharm | 5g | 836.40 Pln | |
| BLDpharm | 25g | 2896.78 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(4-chloro-3,5-difluorophenyl)boronic acid (CAS 864759-63-7) is a chemical compound with the molecular formula C6H4BClF2O2 and a molecular weight of 192.36 g/mol. IUPAC name: (4-chloro-3,5-difluorophenyl)boronic acid. InChIKey: QFZAPMPDGUNQDD-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF2O2 |
|---|---|
| Molecular weight | 192.36 g/mol |
| IUPAC name | (4-chloro-3,5-difluorophenyl)boronic acid |
| InChIKey | QFZAPMPDGUNQDD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)Cl)F)(O)O |
Computed by PubChem (NCBI)