Products 2377610-07-4
CAS 2377610-07-4 appears in our catalog under these names: 5-Chloro-2,3-difluorophenylboronic acid, 95%, (5-Chloro-2,3-difluorophenyl)boronic acid 97%, (5-Chloro-2,3-difluorophenyl)boronic acid, 97%, 97%, 5-Chloro-2,3-difluorophenylboronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
(5-chloro-2,3-difluorophenyl)boronic acid (CAS 2377610-07-4) is a chemical compound with the molecular formula C6H4BClF2O2 and a molecular weight of 192.36 g/mol. IUPAC name: (5-chloro-2,3-difluorophenyl)boronic acid. InChIKey: HQWCUVBLTRKJRJ-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF2O2 |
|---|---|
| Molecular weight | 192.36 g/mol |
| IUPAC name | (5-chloro-2,3-difluorophenyl)boronic acid |
| InChIKey | HQWCUVBLTRKJRJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)F)Cl)(O)O |
Computed by PubChem (NCBI)