CAS 1801916-39-1 appears in our catalog under these names: 2-Chloro-4,5-difluorophenylboronic acid, 95%, (2-Chloro-4,5-difluorophenyl)boronic acid, 98%, 2-Chloro-4,5-difluorophenylboronic acid. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 2,5g.
(2-chloro-4,5-difluorophenyl)boronic acid (CAS 1801916-39-1) is a chemical compound with the molecular formula C6H4BClF2O2 and a molecular weight of 192.36 g/mol. IUPAC name: (2-chloro-4,5-difluorophenyl)boronic acid. InChIKey: MSMGFPOBSXTDFW-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF2O2 |
|---|---|
| Molecular weight | 192.36 g/mol |
| IUPAC name | (2-chloro-4,5-difluorophenyl)boronic acid |
| InChIKey | MSMGFPOBSXTDFW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)F)F)(O)O |
Computed by PubChem (NCBI)