Products 864759-63-7
CAS 864759-63-7 appears in our catalog under these names: 3,5-Difluoro-4-chlorophenylboronic acid, 98%, 3,5–Difluoro–4–chlorophenylboronic acid, (4-Chloro-3,5-difluorophenyl)boronic acid 95%, (4-Chloro-3,5-difluorophenyl)boronic acid, 98%, 98%, (4-Chloro-3,5-difluorophenyl)boronic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 100g, 5g, 250mg, 100mg.
(4-chloro-3,5-difluorophenyl)boronic acid (CAS 864759-63-7) is a chemical compound with the molecular formula C6H4BClF2O2 and a molecular weight of 192.36 g/mol. IUPAC name: (4-chloro-3,5-difluorophenyl)boronic acid. InChIKey: QFZAPMPDGUNQDD-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF2O2 |
|---|---|
| Molecular weight | 192.36 g/mol |
| IUPAC name | (4-chloro-3,5-difluorophenyl)boronic acid |
| InChIKey | QFZAPMPDGUNQDD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)Cl)F)(O)O |
Computed by PubChem (NCBI)