Products 1160561-28-3
CAS 1160561-28-3 appears in our catalog under these names: 4-Chloro-2,3-difluorophenylboronic acid, 98%, 4-Chloro-2,3-difluorophenylboronic acid 98%, 4-Chloro-2,3-difluorophenylboronic acid, 98%, 98%, (4-Chloro-2,3-difluorophenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 100mg.
(4-chloro-2,3-difluorophenyl)boronic acid (CAS 1160561-28-3) is a chemical compound with the molecular formula C6H4BClF2O2 and a molecular weight of 192.36 g/mol. IUPAC name: (4-chloro-2,3-difluorophenyl)boronic acid. InChIKey: QADBJOSUOMFYHK-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF2O2 |
|---|---|
| Molecular weight | 192.36 g/mol |
| IUPAC name | (4-chloro-2,3-difluorophenyl)boronic acid |
| InChIKey | QADBJOSUOMFYHK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)F)F)(O)O |
Computed by PubChem (NCBI)