Products 925911-61-1
CAS 925911-61-1 appears in our catalog under these names: 4-Chloro-2,6-difluorophenylboronic acid, 98%, 4-Chloro-2,6-difluorophenylboronic acid, 4-Chloro-2,6-difluorophenylboronic acid 98%, Boronic acid, B-(4-chloro-2,6-difluorophenyl)-, 98%, 98%, 4-Chloro-2,6-difluorobenzeneboronic acid, 98%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 25g, 100mg.
(4-chloro-2,6-difluorophenyl)boronic acid (CAS 925911-61-1) is a chemical compound with the molecular formula C6H4BClF2O2 and a molecular weight of 192.36 g/mol. IUPAC name: (4-chloro-2,6-difluorophenyl)boronic acid. InChIKey: HJOWOCFSNXZHQW-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF2O2 |
|---|---|
| Molecular weight | 192.36 g/mol |
| IUPAC name | (4-chloro-2,6-difluorophenyl)boronic acid |
| InChIKey | HJOWOCFSNXZHQW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)Cl)F)(O)O |
Computed by PubChem (NCBI)