Products 1031226-45-5
CAS 1031226-45-5 appears in our catalog under these names: 3-Chloro-2,6-difluorophenylboronic acid, 96%, (3-Chloro-2,6-difluorophenyl)boronic acid 98%, 3-CHLORO-2,6-DIFLUOROPHENYLBORONIC ACID, 97%, 97%, (3-Chloro-2,6-difluorophenyl)boronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 100mg.
(3-chloro-2,6-difluorophenyl)boronic acid (CAS 1031226-45-5) is a chemical compound with the molecular formula C6H4BClF2O2 and a molecular weight of 192.36 g/mol. IUPAC name: (3-chloro-2,6-difluorophenyl)boronic acid. InChIKey: ZSMAOKOKSOKHOU-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF2O2 |
|---|---|
| Molecular weight | 192.36 g/mol |
| IUPAC name | (3-chloro-2,6-difluorophenyl)boronic acid |
| InChIKey | ZSMAOKOKSOKHOU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)Cl)F)(O)O |
Computed by PubChem (NCBI)