Products 1310404-70-6
CAS 1310404-70-6 appears in our catalog under these names: 6-Chloro-2,3-difluorophenylboronic acid, 97%, (6-Chloro-2,3-difluorophenyl)boronic acid, 2,3-Difluoro-6-chlorophenylboronic acid, 97%, (6-Chloro-2,3-difluorophenyl)boronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Biosynth, Fluorochem, Chemat. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 0,5g, 100mg.
(6-chloro-2,3-difluorophenyl)boronic acid (CAS 1310404-70-6) is a chemical compound with the molecular formula C6H4BClF2O2 and a molecular weight of 192.36 g/mol. IUPAC name: (6-chloro-2,3-difluorophenyl)boronic acid. InChIKey: RHNKPSDBENIMIS-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF2O2 |
|---|---|
| Molecular weight | 192.36 g/mol |
| IUPAC name | (6-chloro-2,3-difluorophenyl)boronic acid |
| InChIKey | RHNKPSDBENIMIS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)F)Cl)(O)O |
Computed by PubChem (NCBI)