Products 1310384-18-9
CAS 1310384-18-9 appears in our catalog under these names: 3-Chloro-2,4-difluorophenylboronic acid, 98%, 3-Chloro-2,4-difluorobenzeneboronic acid, 90%, (3-Chloro-2,4-difluorophenyl)boronic acid, 98%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg, 25g, 100mg.
(3-chloro-2,4-difluorophenyl)boronic acid (CAS 1310384-18-9) is a chemical compound with the molecular formula C6H4BClF2O2 and a molecular weight of 192.36 g/mol. IUPAC name: (3-chloro-2,4-difluorophenyl)boronic acid. InChIKey: FEZRHYMTLJNUTK-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF2O2 |
|---|---|
| Molecular weight | 192.36 g/mol |
| IUPAC name | (3-chloro-2,4-difluorophenyl)boronic acid |
| InChIKey | FEZRHYMTLJNUTK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)Cl)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3-chloro-2,4-difluorophenyl)boronic acid, 3-Chloro-2,4-difluorophenylboronic acid, 3-Chloro-2,4-difluorobenzeneboronic acid, (3-chloro-2,4-difluoro-phenyl)boronic Acid, Boronic acid, B-(3-chloro-2,4-difluorophenyl)-, (3-chloro-2,4-difluorophenyl)boronicacid, (3-chloro-2,4-difluor, Boronicacid,B-(3-chloro-2,4-difluorophenyl)-, (3-Chloro-2,4-difluorophenyl)boronic acid(contains varying amounts of Anhydride)