Products 2121511-30-4
CAS 2121511-30-4 appears in our catalog under these names: 2-Chloro-3,4-difluorophenylboronic acid, 95%, 2-Chloro-3,4-difluorophenylboronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 500mg.
(2-chloro-3,4-difluorophenyl)boronic acid (CAS 2121511-30-4) is a chemical compound with the molecular formula C6H4BClF2O2 and a molecular weight of 192.36 g/mol. IUPAC name: (2-chloro-3,4-difluorophenyl)boronic acid. InChIKey: LZTHAYZFDYNMHE-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF2O2 |
|---|---|
| Molecular weight | 192.36 g/mol |
| IUPAC name | (2-chloro-3,4-difluorophenyl)boronic acid |
| InChIKey | LZTHAYZFDYNMHE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)F)Cl)(O)O |
Computed by PubChem (NCBI)