Products 1643467-84-8
CAS 1643467-84-8 appears in our catalog under these names: 3-Chloro-4,5-difluorophenylboronic acid, 95%, (3-Chloro-4,5-difluorophenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(3-chloro-4,5-difluorophenyl)boronic acid (CAS 1643467-84-8) is a chemical compound with the molecular formula C6H4BClF2O2 and a molecular weight of 192.36 g/mol. IUPAC name: (3-chloro-4,5-difluorophenyl)boronic acid. InChIKey: SKVAJRYSVMMITI-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF2O2 |
|---|---|
| Molecular weight | 192.36 g/mol |
| IUPAC name | (3-chloro-4,5-difluorophenyl)boronic acid |
| InChIKey | SKVAJRYSVMMITI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)F)F)(O)O |
Computed by PubChem (NCBI)