(4-Formyl-2,6-dimethoxyphenyl)boronic acid 98%
cas: 1256355-34-6 — see every product listed under this CAS number, including other names
(4-Formyl-2,6-dimethoxyphenyl)boronic acid 98% (CAS 1256355-34-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A429171-100mg |
| cas | 1256355-34-6 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 587.31 Pln | |
| Ambeed | 250mg | 904.38 Pln | |
| Ambeed | 1g | 1738.75 Pln | |
| Ambeed | 5g | 6122.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A429171 |
(4-formyl-2,6-dimethoxyphenyl)boronic acid (CAS 1256355-34-6) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: (4-formyl-2,6-dimethoxyphenyl)boronic acid. InChIKey: SNAHFCPYLSJIAT-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | (4-formyl-2,6-dimethoxyphenyl)boronic acid |
| InChIKey | SNAHFCPYLSJIAT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1OC)C=O)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,6-Dimethoxy-4-formylphenylboronic acid, (4-formyl-2,6-dimethoxyphenyl)boronic acid, 2,6-Dimethoxy-4-formylbenzeneboronic acid, Boronic acid, B-(4-formyl-2,6-dimethoxyphenyl)-, (4-formyl-2,6-dimethoxy-phenyl)boronic Acid, 4-Borono-3,5-dimethoxybenzaldehyde, (4-formyl-2,6-dimethoxyphenyl)boronicacid