cas: 2001080-85-7 — see every product listed under this CAS number, including other names
(4-Formyl-3,5-Dimethoxyphenyl)Boronic Acid, 97%, 97% (CAS 2001080-85-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113CIY-100mg |
| cas | 2001080-85-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 328.40 Pln | |
| Chemat | 10g | 587.60 Pln | |
| Chemat | 25g | 1379.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4-formyl-3,5-dimethoxyphenyl)boronic acid (CAS 2001080-85-7) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: (4-formyl-3,5-dimethoxyphenyl)boronic acid. InChIKey: AMCMBLFQAZPIPI-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | (4-formyl-3,5-dimethoxyphenyl)boronic acid |
| InChIKey | AMCMBLFQAZPIPI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)OC)C=O)OC)(O)O |
Computed by PubChem (NCBI)