cas: 2001080-85-7 — see every product listed under this CAS number, including other names
(4-Formyl-3,5-dimethoxyphenyl)boronic acid, 96% (CAS 2001080-85-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F461745-1G |
| cas | 2001080-85-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 518.59 Pln | |
| Fluorochem | 10g | 950.72 Pln | |
| Fluorochem | 25g | 1955.58 Pln | |
| Fluorochem | 100g | 6136.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
(4-formyl-3,5-dimethoxyphenyl)boronic acid (CAS 2001080-85-7) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: (4-formyl-3,5-dimethoxyphenyl)boronic acid. InChIKey: AMCMBLFQAZPIPI-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | (4-formyl-3,5-dimethoxyphenyl)boronic acid |
| InChIKey | AMCMBLFQAZPIPI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)OC)C=O)OC)(O)O |
Computed by PubChem (NCBI)