cas: 1256355-40-4 — see every product listed under this CAS number, including other names
(4-Methoxy-2-(methoxycarbonyl)phenyl)boronic acid 96% (CAS 1256355-40-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A729985-100mg |
| cas | 1256355-40-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 832.06 Pln | |
| Ambeed | 250mg | 1238.12 Pln | |
| Ambeed | 1g | 2662.12 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A729985 |
(4-methoxy-2-methoxycarbonylphenyl)boronic acid (CAS 1256355-40-4) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: (4-methoxy-2-methoxycarbonylphenyl)boronic acid. InChIKey: QJEMXKRTNMWVHO-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | (4-methoxy-2-methoxycarbonylphenyl)boronic acid |
| InChIKey | QJEMXKRTNMWVHO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC)C(=O)OC)(O)O |
Computed by PubChem (NCBI)